C16H19ClF3N3O2 — CID 123514144
2,2,2-trifluoroethyl N'-[N-[(E)-4-chloro-5-oxo-2-prop-1-enylhex-2-enyl]-C-ethenylcarbonimidoyl]-N-methylidenecarbamimidate (PubChem CID 123514144) has the molecular formula C16H19ClF3N3O2 and a molecular weight of 377.79 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N'-[N-[(E)-4-chloro-5-oxo-2-prop-1-enylhex-2-enyl]-C-ethenylcarbonimidoyl]-N-methylidenecarbamimidate.
| Compound Name | 2,2,2-trifluoroethyl N'-[N-[(E)-4-chloro-5-oxo-2-prop-1-enylhex-2-enyl]-C-ethenylcarbonimidoyl]-N-methylidenecarbamimidate |
|---|---|
| PubChem CID | 123514144 |
| Molecular Formula | C16H19ClF3N3O2 |
| Molecular Weight | 377.79 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2,2,2-trifluoroethyl N'-[N-[(E)-4-chloro-5-oxo-2-prop-1-enylhex-2-enyl]-C-ethenylcarbonimidoyl]-N-methylidenecarbamimidate |
| SMILES | C=CC(=N\C/C(C=CC)=C/C(Cl)C(C)=O)/N=C(\N=C)OCC(F)(F)F |
| InChI | InChI=1S/C16H19ClF3N3O2/c1-5-7-12(8-13(17)11(3)24)9-22-14(6-2)23-15(21-4)25-10-16(18,19)20/h5-8,13H,2,4,9-10H2,1,3H3/b7-5?,12-8+,22-14+,23-15+ |
| InChIKey | YEOHGHAVNSBFDL-NWDJCZLQSA-N |
| XLogP | 3.91 |
| TPSA | 63.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.79 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|