C10H13F3O4 — CID 87690665
2-methylbut-2-enoic acid;2,2,2-trifluoroethyl prop-2-enoate (PubChem CID 87690665) has the molecular formula C10H13F3O4 and a molecular weight of 254.20 g/mol. Its IUPAC name is 2-methylbut-2-enoic acid;2,2,2-trifluoroethyl prop-2-enoate.
| Compound Name | 2-methylbut-2-enoic acid;2,2,2-trifluoroethyl prop-2-enoate |
|---|---|
| PubChem CID | 87690665 |
| Molecular Formula | C10H13F3O4 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 2-methylbut-2-enoic acid;2,2,2-trifluoroethyl prop-2-enoate |
| SMILES | C=CC(=O)OCC(F)(F)F.CC=C(C)C(=O)O |
| InChI | InChI=1S/C5H5F3O2.C5H8O2/c1-2-4(9)10-3-5(6,7)8;1-3-4(2)5(6)7/h2H,1,3H2;3H,1-2H3,(H,6,7) |
| InChIKey | IBDMAHFRAFXRNY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|