C10H12ClF3O — CID 89265303
(2Z,4E,6Z)-3-chloro-5-(2,2,2-trifluoroethoxy)octa-2,4,6-triene (PubChem CID 89265303) has the molecular formula C10H12ClF3O and a molecular weight of 240.65 g/mol. Its IUPAC name is (2Z,4E,6Z)-3-chloro-5-(2,2,2-trifluoroethoxy)octa-2,4,6-triene.
| Compound Name | (2Z,4E,6Z)-3-chloro-5-(2,2,2-trifluoroethoxy)octa-2,4,6-triene |
|---|---|
| PubChem CID | 89265303 |
| Molecular Formula | C10H12ClF3O |
| Molecular Weight | 240.65 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | (2Z,4E,6Z)-3-chloro-5-(2,2,2-trifluoroethoxy)octa-2,4,6-triene |
| SMILES | C/C=C\C(=C/C(Cl)=C/C)OCC(F)(F)F |
| InChI | InChI=1S/C10H12ClF3O/c1-3-5-9(6-8(11)4-2)15-7-10(12,13)14/h3-6H,7H2,1-2H3/b5-3-,8-4-,9-6+ |
| InChIKey | ROBPBWDREWARNO-UWXVWKBMSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.65 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|