C7H11N — CID 142024133
N-[(2E,4Z)-hexa-2,4-dien-3-yl]methanimine (PubChem CID 142024133) has the molecular formula C7H11N and a molecular weight of 109.17 g/mol. Its IUPAC name is N-[(2E,4Z)-hexa-2,4-dien-3-yl]methanimine.
| Compound Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]methanimine |
|---|---|
| PubChem CID | 142024133 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | N-[(2E,4Z)-hexa-2,4-dien-3-yl]methanimine |
| SMILES | C=NC(/C=C\C)=C/C |
| InChI | InChI=1S/C7H11N/c1-4-6-7(5-2)8-3/h4-6H,3H2,1-2H3/b6-4-,7-5+ |
| InChIKey | ODPCYLCNZIPDDA-XGXWUAJZSA-N |
| XLogP | 2.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|