C9H15N3 — CID 166953787
1,2-dimethyl-3-methylidene-1-[(3Z)-penta-1,3-dien-2-yl]guanidine (PubChem CID 166953787) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 1,2-dimethyl-3-methylidene-1-[(3Z)-penta-1,3-dien-2-yl]guanidine.
| Compound Name | 1,2-dimethyl-3-methylidene-1-[(3Z)-penta-1,3-dien-2-yl]guanidine |
|---|---|
| PubChem CID | 166953787 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 1,2-dimethyl-3-methylidene-1-[(3Z)-penta-1,3-dien-2-yl]guanidine |
| SMILES | C=N/C(=N\C)N(C)C(=C)/C=C\C |
| InChI | InChI=1S/C9H15N3/c1-6-7-8(2)12(5)9(10-3)11-4/h6-7H,2-3H2,1,4-5H3/b7-6-,11-9+ |
| InChIKey | IOIRCKGFPYIECF-SXWITGCCSA-N |
| XLogP | 1.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|