About (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine
(3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine (PubChem CID 130331308) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine.
Molecular Properties
| Compound Name | (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine |
| PubChem CID | 130331308 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine |
| SMILES | C=C(/C=C\C)N(CC(C)C)CC(C)C |
| InChI | InChI=1S/C13H25N/c1-7-8-13(6)14(9-11(2)3)10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7- |
| InChIKey | JIMHKIIYKTWSIN-FPLPWBNLSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine?
The IUPAC name of (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine (CID 130331308) is (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine.
What is the SMILES notation for (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine?
The canonical SMILES for (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine is C=C(/C=C\C)N(CC(C)C)CC(C)C.
What is the InChIKey of (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine?
The InChIKey is JIMHKIIYKTWSIN-FPLPWBNLSA-N. The full InChI is InChI=1S/C13H25N/c1-7-8-13(6)14(9-11(2)3)10-12(4)5/h7-8,11-12H,6,9-10H2,1-5H3/b8-7-.
What are the key properties of (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine?
(3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine has a molecular weight of 195.35 g/mol, XLogP of 3.69, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-N,N-bis(2-methylpropyl)penta-1,3-dien-2-amine is sourced from PubChem (CID 130331308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).