C18H35N — CID 166671404
N-(2,3-dimethylbutan-2-yl)-2,4-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]pentan-2-amine (PubChem CID 166671404) has the molecular formula C18H35N and a molecular weight of 265.48 g/mol. Its IUPAC name is N-(2,3-dimethylbutan-2-yl)-2,4-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]pentan-2-amine.
| Compound Name | N-(2,3-dimethylbutan-2-yl)-2,4-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]pentan-2-amine |
|---|---|
| PubChem CID | 166671404 |
| Molecular Formula | C18H35N |
| Molecular Weight | 265.48 g/mol |
| Exact Mass | 265.28 |
| IUPAC Name | N-(2,3-dimethylbutan-2-yl)-2,4-dimethyl-N-[(3E)-penta-1,3-dien-2-yl]pentan-2-amine |
| SMILES | C=C(/C=C/C)N(C(C)(C)CC(C)C)C(C)(C)C(C)C |
| InChI | InChI=1S/C18H35N/c1-11-12-16(6)19(18(9,10)15(4)5)17(7,8)13-14(2)3/h11-12,14-15H,6,13H2,1-5,7-10H3/b12-11+ |
| InChIKey | HRCLBVYUKFLGSV-VAWYXSNFSA-N |
| XLogP | 5.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|