C14H19N — CID 146321112
(3Z)-N-ethenyl-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]hexa-1,3,5-trien-2-amine (PubChem CID 146321112) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (3Z)-N-ethenyl-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]hexa-1,3,5-trien-2-amine.
| Compound Name | (3Z)-N-ethenyl-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 146321112 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (3Z)-N-ethenyl-4-methyl-N-[(3Z)-penta-1,3-dien-2-yl]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(C)=C\C(=C)N(C=C)C(=C)/C=C\C |
| InChI | InChI=1S/C14H19N/c1-7-10-13(5)15(9-3)14(6)11-12(4)8-2/h7-11H,2-3,5-6H2,1,4H3/b10-7-,12-11- |
| InChIKey | MDMFAKMSQGGTHW-NEFYYVMFSA-N |
| XLogP | 4.17 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|