C14H21N — CID 118973859
(5Z)-N-methyl-4-methylidene-N-[(3Z)-penta-1,3-dien-2-yl]hepta-1,5-dien-2-amine (PubChem CID 118973859) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is (5Z)-N-methyl-4-methylidene-N-[(3Z)-penta-1,3-dien-2-yl]hepta-1,5-dien-2-amine.
| Compound Name | (5Z)-N-methyl-4-methylidene-N-[(3Z)-penta-1,3-dien-2-yl]hepta-1,5-dien-2-amine |
|---|---|
| PubChem CID | 118973859 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | (5Z)-N-methyl-4-methylidene-N-[(3Z)-penta-1,3-dien-2-yl]hepta-1,5-dien-2-amine |
| SMILES | C=C(/C=C\C)CC(=C)N(C)C(=C)/C=C\C |
| InChI | InChI=1S/C14H21N/c1-7-9-12(3)11-14(5)15(6)13(4)10-8-2/h7-10H,3-5,11H2,1-2,6H3/b9-7-,10-8- |
| InChIKey | QPNPSFKRARWDMB-XOHWUJONSA-N |
| XLogP | 4.04 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|