C10H16O — CID 144612392
buta-1,3-dien-2-ol;(3Z)-2-methylpenta-1,3-diene (PubChem CID 144612392) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is buta-1,3-dien-2-ol;(3Z)-2-methylpenta-1,3-diene.
| Compound Name | buta-1,3-dien-2-ol;(3Z)-2-methylpenta-1,3-diene |
|---|---|
| PubChem CID | 144612392 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | buta-1,3-dien-2-ol;(3Z)-2-methylpenta-1,3-diene |
| SMILES | C=C(C)/C=C\C.C=CC(=C)O |
| InChI | InChI=1S/C6H10.C4H6O/c1-4-5-6(2)3;1-3-4(2)5/h4-5H,2H2,1,3H3;3,5H,1-2H2/b5-4-; |
| InChIKey | BBNKWMBRXOEUSY-MKWAYWHRSA-N |
| XLogP | 3.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|