C8H12O — CID 89289034
(3E,5Z)-3-methylhepta-1,3,5-trien-4-ol (PubChem CID 89289034) has the molecular formula C8H12O and a molecular weight of 124.18 g/mol. Its IUPAC name is (3E,5Z)-3-methylhepta-1,3,5-trien-4-ol.
| Compound Name | (3E,5Z)-3-methylhepta-1,3,5-trien-4-ol |
|---|---|
| PubChem CID | 89289034 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (3E,5Z)-3-methylhepta-1,3,5-trien-4-ol |
| SMILES | C=C/C(C)=C(O)\C=C/C |
| InChI | InChI=1S/C8H12O/c1-4-6-8(9)7(3)5-2/h4-6,9H,2H2,1,3H3/b6-4-,8-7+ |
| InChIKey | UGRFNZNDQPVOPN-IQTBQJLQSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|