C14H17N — CID 171844731
N-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]aniline (PubChem CID 171844731) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is N-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]aniline.
| Compound Name | N-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]aniline |
|---|---|
| PubChem CID | 171844731 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | N-[(3E,5Z)-3-methylhepta-1,3,5-trien-4-yl]aniline |
| SMILES | C=C/C(C)=C(\C=C/C)Nc1ccccc1 |
| InChI | InChI=1S/C14H17N/c1-4-9-14(12(3)5-2)15-13-10-7-6-8-11-13/h4-11,15H,2H2,1,3H3/b9-4-,14-12+ |
| InChIKey | RSUWTMZTZBQPJU-RVGMHUQZSA-N |
| XLogP | 4.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|