C13H13N — CID 170309596
N-[(2E)-hepta-2,6-dien-4-yn-3-yl]aniline (PubChem CID 170309596) has the molecular formula C13H13N and a molecular weight of 183.25 g/mol. Its IUPAC name is N-[(2E)-hepta-2,6-dien-4-yn-3-yl]aniline.
| Compound Name | N-[(2E)-hepta-2,6-dien-4-yn-3-yl]aniline |
|---|---|
| PubChem CID | 170309596 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | N-[(2E)-hepta-2,6-dien-4-yn-3-yl]aniline |
| SMILES | C=CC#C/C(=C\C)Nc1ccccc1 |
| InChI | InChI=1S/C13H13N/c1-3-5-9-12(4-2)14-13-10-7-6-8-11-13/h3-4,6-8,10-11,14H,1H2,2H3/b12-4+ |
| InChIKey | NPBWIEMQRLIIFK-UUILKARUSA-N |
| XLogP | 3.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|