C15H25N — CID 143322906
ethane;N-[(3E)-penta-1,3-dien-3-yl]aniline (PubChem CID 143322906) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is ethane;N-[(3E)-penta-1,3-dien-3-yl]aniline.
| Compound Name | ethane;N-[(3E)-penta-1,3-dien-3-yl]aniline |
|---|---|
| PubChem CID | 143322906 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | ethane;N-[(3E)-penta-1,3-dien-3-yl]aniline |
| SMILES | C=C/C(=C\C)Nc1ccccc1.CC.CC |
| InChI | InChI=1S/C11H13N.2C2H6/c1-3-10(4-2)12-11-8-6-5-7-9-11;2*1-2/h3-9,12H,1H2,2H3;2*1-2H3/b10-4+;; |
| InChIKey | MLBDTPRADLBNSS-JPRUNYMKSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|