C31H27N — CID 139294862
3-phenyl-N-[(3E,5E)-6-(3-phenylphenyl)hepta-1,3,5-trien-3-yl]aniline (PubChem CID 139294862) has the molecular formula C31H27N and a molecular weight of 413.56 g/mol. Its IUPAC name is 3-phenyl-N-[(3E,5E)-6-(3-phenylphenyl)hepta-1,3,5-trien-3-yl]aniline.
| Compound Name | 3-phenyl-N-[(3E,5E)-6-(3-phenylphenyl)hepta-1,3,5-trien-3-yl]aniline |
|---|---|
| PubChem CID | 139294862 |
| Molecular Formula | C31H27N |
| Molecular Weight | 413.56 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 3-phenyl-N-[(3E,5E)-6-(3-phenylphenyl)hepta-1,3,5-trien-3-yl]aniline |
| SMILES | C=C/C(=C\C=C(/C)c1cccc(-c2ccccc2)c1)Nc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C31H27N/c1-3-30(32-31-19-11-18-29(23-31)26-14-8-5-9-15-26)21-20-24(2)27-16-10-17-28(22-27)25-12-6-4-7-13-25/h3-23,32H,1H2,2H3/b24-20+,30-21+ |
| InChIKey | FSGIYUPOTSIHHY-ZZPWFQJHSA-N |
| XLogP | 8.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.56 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|