C20H25N — CID 145000931
ethane;(1Z)-4-methyl-1-(3-phenylphenyl)penta-1,3-dien-1-amine (PubChem CID 145000931) has the molecular formula C20H25N and a molecular weight of 279.43 g/mol. Its IUPAC name is ethane;(1Z)-4-methyl-1-(3-phenylphenyl)penta-1,3-dien-1-amine.
| Compound Name | ethane;(1Z)-4-methyl-1-(3-phenylphenyl)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145000931 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | ethane;(1Z)-4-methyl-1-(3-phenylphenyl)penta-1,3-dien-1-amine |
| SMILES | CC.CC(C)=C/C=C(\N)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N.C2H6/c1-14(2)11-12-18(19)17-10-6-9-16(13-17)15-7-4-3-5-8-15;1-2/h3-13H,19H2,1-2H3;1-2H3/b18-12-; |
| InChIKey | LJUBQBZTZOSQBP-UWRQUICRSA-N |
| XLogP | 5.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|