C12H15N — CID 143300629
(1Z)-4-methyl-1-phenylpenta-1,3-dien-1-amine (PubChem CID 143300629) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is (1Z)-4-methyl-1-phenylpenta-1,3-dien-1-amine.
| Compound Name | (1Z)-4-methyl-1-phenylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 143300629 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | (1Z)-4-methyl-1-phenylpenta-1,3-dien-1-amine |
| SMILES | CC(C)=C/C=C(\N)c1ccccc1 |
| InChI | InChI=1S/C12H15N/c1-10(2)8-9-12(13)11-6-4-3-5-7-11/h3-9H,13H2,1-2H3/b12-9- |
| InChIKey | DJMJWJGKUBIUIT-XFXZXTDPSA-N |
| XLogP | 2.95 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|