About (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane
(Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane (PubChem CID 143992589) has the molecular formula C40H37N2P
and a molecular weight of 576.72 g/mol. Its IUPAC name is (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane.
Molecular Properties
| Compound Name | (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane |
| PubChem CID | 143992589 |
| Molecular Formula | C40H37N2P |
| Molecular Weight | 576.72 g/mol |
| Exact Mass | 576.27 |
| IUPAC Name | (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane |
| SMILES | C/C(Nc1cccc(-c2ccccc2)c1)=C(\C)Nc1cccc(-c2ccccc2)c1.Pc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2.C12H11P/c1-21(29-27-17-9-15-25(19-27)23-11-5-3-6-12-23)22(2)30-28-18-10-16-26(20-28)24-13-7-4-8-14-24;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h3-20,29-30H,1-2H3;1-9H,13H2/b22-21-; |
| InChIKey | XTLYYXXNIFQMHS-SVXKRPBISA-N |
| XLogP | 10.65 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.72 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane?
The IUPAC name of (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane (CID 143992589) is (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane.
What is the SMILES notation for (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane?
The canonical SMILES for (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane is C/C(Nc1cccc(-c2ccccc2)c1)=C(\C)Nc1cccc(-c2ccccc2)c1.Pc1ccc(-c2ccccc2)cc1.
What is the InChIKey of (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane?
The InChIKey is XTLYYXXNIFQMHS-SVXKRPBISA-N. The full InChI is InChI=1S/C28H26N2.C12H11P/c1-21(29-27-17-9-15-25(19-27)23-11-5-3-6-12-23)22(2)30-28-18-10-16-26(20-28)24-13-7-4-8-14-24;13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h3-20,29-30H,1-2H3;1-9H,13H2/b22-21-;.
What are the key properties of (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane?
(Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane has a molecular weight of 576.72 g/mol, XLogP of 10.65, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-N,3-N-bis(3-phenylphenyl)but-2-ene-2,3-diamine;(4-phenylphenyl)phosphane is sourced from PubChem (CID 143992589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).