C13H15NO — CID 143069328
2-[[(3E)-penta-1,3-dien-3-yl]amino]-1-phenylethanone (PubChem CID 143069328) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 2-[[(3E)-penta-1,3-dien-3-yl]amino]-1-phenylethanone.
| Compound Name | 2-[[(3E)-penta-1,3-dien-3-yl]amino]-1-phenylethanone |
|---|---|
| PubChem CID | 143069328 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 2-[[(3E)-penta-1,3-dien-3-yl]amino]-1-phenylethanone |
| SMILES | C=C/C(=C\C)NCC(=O)c1ccccc1 |
| InChI | InChI=1S/C13H15NO/c1-3-12(4-2)14-10-13(15)11-8-6-5-7-9-11/h3-9,14H,1,10H2,2H3/b12-4+ |
| InChIKey | CWNDLXRSPXTCFV-UUILKARUSA-N |
| XLogP | 2.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|