About 2-(ethylamino)-1-phenylethanone;methanol
2-(ethylamino)-1-phenylethanone;methanol (PubChem CID 143922516) has the molecular formula C11H17NO2
and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-(ethylamino)-1-phenylethanone;methanol.
Molecular Properties
| Compound Name | 2-(ethylamino)-1-phenylethanone;methanol |
| PubChem CID | 143922516 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-(ethylamino)-1-phenylethanone;methanol |
| SMILES | CCNCC(=O)c1ccccc1.CO |
| InChI | InChI=1S/C10H13NO.CH4O/c1-2-11-8-10(12)9-6-4-3-5-7-9;1-2/h3-7,11H,2,8H2,1H3;2H,1H3 |
| InChIKey | QYNBFGSITWSWKG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(ethylamino)-1-phenylethanone;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-1-phenylethanone;methanol?
The IUPAC name of 2-(ethylamino)-1-phenylethanone;methanol (CID 143922516) is 2-(ethylamino)-1-phenylethanone;methanol.
What is the SMILES notation for 2-(ethylamino)-1-phenylethanone;methanol?
The canonical SMILES for 2-(ethylamino)-1-phenylethanone;methanol is CCNCC(=O)c1ccccc1.CO.
What is the InChIKey of 2-(ethylamino)-1-phenylethanone;methanol?
The InChIKey is QYNBFGSITWSWKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO.CH4O/c1-2-11-8-10(12)9-6-4-3-5-7-9;1-2/h3-7,11H,2,8H2,1H3;2H,1H3.
What are the key properties of 2-(ethylamino)-1-phenylethanone;methanol?
2-(ethylamino)-1-phenylethanone;methanol has a molecular weight of 195.26 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-1-phenylethanone;methanol is sourced from PubChem (CID 143922516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).