C14H15NO2 — CID 145172295
(2E,3E)-3-anilino-2-ethylidenehexa-3,5-dienoic acid (PubChem CID 145172295) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2E,3E)-3-anilino-2-ethylidenehexa-3,5-dienoic acid.
| Compound Name | (2E,3E)-3-anilino-2-ethylidenehexa-3,5-dienoic acid |
|---|---|
| PubChem CID | 145172295 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | (2E,3E)-3-anilino-2-ethylidenehexa-3,5-dienoic acid |
| SMILES | C=C/C=C(Nc1ccccc1)\C(=C/C)C(=O)O |
| InChI | InChI=1S/C14H15NO2/c1-3-8-13(12(4-2)14(16)17)15-11-9-6-5-7-10-11/h3-10,15H,1H2,2H3,(H,16,17)/b12-4+,13-8+ |
| InChIKey | GMLDTUMGWJDLCH-KMIQJRPCSA-N |
| XLogP | 3.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|