C16H26N2O — CID 142888465
(E,2E)-3-amino-2-ethylidene-N-phenylpent-3-enamide;ethane;methane (PubChem CID 142888465) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is (E,2E)-3-amino-2-ethylidene-N-phenylpent-3-enamide;ethane;methane.
| Compound Name | (E,2E)-3-amino-2-ethylidene-N-phenylpent-3-enamide;ethane;methane |
|---|---|
| PubChem CID | 142888465 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (E,2E)-3-amino-2-ethylidene-N-phenylpent-3-enamide;ethane;methane |
| SMILES | C.C/C=C(N)\C(=C/C)C(=O)Nc1ccccc1.CC |
| InChI | InChI=1S/C13H16N2O.C2H6.CH4/c1-3-11(12(14)4-2)13(16)15-10-8-6-5-7-9-10;1-2;/h3-9H,14H2,1-2H3,(H,15,16);1-2H3;1H4/b11-3+,12-4+;; |
| InChIKey | OTEWNQSBLSJAIY-CARBNFPJSA-N |
| XLogP | 4.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|