C16H18N2O2 — CID 175630260
1-N'-[(2E)-penta-2,4-dien-2-yl]-1-N-phenylcyclopropane-1,1-dicarboxamide (PubChem CID 175630260) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 1-N'-[(2E)-penta-2,4-dien-2-yl]-1-N-phenylcyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[(2E)-penta-2,4-dien-2-yl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 175630260 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-N'-[(2E)-penta-2,4-dien-2-yl]-1-N-phenylcyclopropane-1,1-dicarboxamide |
| SMILES | C=C/C=C(\C)NC(=O)C1(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C16H18N2O2/c1-3-7-12(2)17-14(19)16(10-11-16)15(20)18-13-8-5-4-6-9-13/h3-9H,1,10-11H2,2H3,(H,17,19)(H,18,20)/b12-7+ |
| InChIKey | PCPURIDCBHKVRN-KPKJPENVSA-N |
| XLogP | 2.61 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|