C14H16S — CID 167148122
[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]sulfanylbenzene (PubChem CID 167148122) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is [(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]sulfanylbenzene.
| Compound Name | [(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 167148122 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | [(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]sulfanylbenzene |
| SMILES | C=C/C(Sc1ccccc1)=C(C)\C=C/C |
| InChI | InChI=1S/C14H16S/c1-4-9-12(3)14(5-2)15-13-10-7-6-8-11-13/h4-11H,2H2,1,3H3/b9-4-,14-12+ |
| InChIKey | ZUEVSOGBCPHCSC-RVGMHUQZSA-N |
| XLogP | 4.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|