C18H18S — CID 144677177
benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene (PubChem CID 144677177) has the molecular formula C18H18S and a molecular weight of 266.41 g/mol. Its IUPAC name is benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene.
| Compound Name | benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene |
|---|---|
| PubChem CID | 144677177 |
| Molecular Formula | C18H18S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene |
| SMILES | C=C/C=C(\C=C)Sc1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C12H12S.C6H6/c1-3-8-11(4-2)13-12-9-6-5-7-10-12;1-2-4-6-5-3-1/h3-10H,1-2H2;1-6H/b11-8+; |
| InChIKey | NCUBBGCBMUMGJD-YGCVIUNWSA-N |
| XLogP | 5.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|