C20H26O2S — CID 145144491
benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanol (PubChem CID 145144491) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanol.
| Compound Name | benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanol |
|---|---|
| PubChem CID | 145144491 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | benzene;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanol |
| SMILES | C=C/C=C(\C=C)Sc1ccccc1.CO.CO.c1ccccc1 |
| InChI | InChI=1S/C12H12S.C6H6.2CH4O/c1-3-8-11(4-2)13-12-9-6-5-7-10-12;1-2-4-6-5-3-1;2*1-2/h3-10H,1-2H2;1-6H;2*2H,1H3/b11-8+;;; |
| InChIKey | MHGURIGIWWYZHQ-CYXWJPPTSA-N |
| XLogP | 4.94 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|