C15H23NS — CID 142464994
ethane;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanamine (PubChem CID 142464994) has the molecular formula C15H23NS and a molecular weight of 249.42 g/mol. Its IUPAC name is ethane;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanamine.
| Compound Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanamine |
|---|---|
| PubChem CID | 142464994 |
| Molecular Formula | C15H23NS |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | ethane;[(3E)-hexa-1,3,5-trien-3-yl]sulfanylbenzene;methanamine |
| SMILES | C=C/C=C(\C=C)Sc1ccccc1.CC.CN |
| InChI | InChI=1S/C12H12S.C2H6.CH5N/c1-3-8-11(4-2)13-12-9-6-5-7-10-12;2*1-2/h3-10H,1-2H2;1-2H3;2H2,1H3/b11-8+;; |
| InChIKey | PJFJOWYINASOGJ-OHENRDTHSA-N |
| XLogP | 4.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|