C26H24N2 — CID 145444791
(3Z,5Z)-4-N-[4-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyl)phenyl]-3-N-phenylhepta-1,3,5-triene-3,4-diamine (PubChem CID 145444791) has the molecular formula C26H24N2 and a molecular weight of 364.49 g/mol. Its IUPAC name is (3Z,5Z)-4-N-[4-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyl)phenyl]-3-N-phenylhepta-1,3,5-triene-3,4-diamine.
| Compound Name | (3Z,5Z)-4-N-[4-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyl)phenyl]-3-N-phenylhepta-1,3,5-triene-3,4-diamine |
|---|---|
| PubChem CID | 145444791 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | (3Z,5Z)-4-N-[4-(3-bicyclo[4.1.0]hepta-1(6),2,4-trienyl)phenyl]-3-N-phenylhepta-1,3,5-triene-3,4-diamine |
| SMILES | C=C/C(Nc1ccccc1)=C(\C=C/C)Nc1ccc(-c2ccc3c(c2)C3)cc1 |
| InChI | InChI=1S/C26H24N2/c1-3-8-26(25(4-2)27-23-9-6-5-7-10-23)28-24-15-13-19(14-16-24)20-11-12-21-18-22(21)17-20/h3-17,27-28H,2,18H2,1H3/b8-3-,26-25- |
| InChIKey | KPVDRSBBVSANIB-OITQSIMESA-N |
| XLogP | 6.76 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|