C25H31N — CID 145407854
ethane;N-[(2E,4E)-5-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]-4-phenylaniline (PubChem CID 145407854) has the molecular formula C25H31N and a molecular weight of 345.53 g/mol. Its IUPAC name is ethane;N-[(2E,4E)-5-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]-4-phenylaniline.
| Compound Name | ethane;N-[(2E,4E)-5-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]-4-phenylaniline |
|---|---|
| PubChem CID | 145407854 |
| Molecular Formula | C25H31N |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.25 |
| IUPAC Name | ethane;N-[(2E,4E)-5-methyl-4-[(Z)-prop-1-enyl]hepta-2,4,6-trien-3-yl]-4-phenylaniline |
| SMILES | C=C/C(C)=C(\C=C/C)C(=C\C)/Nc1ccc(-c2ccccc2)cc1.CC |
| InChI | InChI=1S/C23H25N.C2H6/c1-5-11-22(18(4)6-2)23(7-3)24-21-16-14-20(15-17-21)19-12-9-8-10-13-19;1-2/h5-17,24H,2H2,1,3-4H3;1-2H3/b11-5-,22-18+,23-7+; |
| InChIKey | IFSLCAJCAIHRIB-RFAJZKRASA-N |
| XLogP | 7.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|