C24H23N — CID 142541124
N-[(3Z,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraen-3-yl]-4-phenylaniline (PubChem CID 142541124) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[(3Z,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraen-3-yl]-4-phenylaniline.
| Compound Name | N-[(3Z,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraen-3-yl]-4-phenylaniline |
|---|---|
| PubChem CID | 142541124 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | N-[(3Z,5E)-4,5-bis(ethenyl)octa-1,3,5,7-tetraen-3-yl]-4-phenylaniline |
| SMILES | C=C/C=C(C=C)/C(C=C)=C(/C=C)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N/c1-5-12-19(6-2)23(7-3)24(8-4)25-22-17-15-21(16-18-22)20-13-10-9-11-14-20/h5-18,25H,1-4H2/b19-12+,24-23- |
| InChIKey | UZSSBAAWWGWRGM-CDYFAGBUSA-N |
| XLogP | 6.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|