C19H17NO — CID 144927496
(3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-one (PubChem CID 144927496) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is (3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-one.
| Compound Name | (3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 144927496 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | (3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C=C)C(=O)Cc1ccc(-c2ccccc2)cn1 |
| InChI | InChI=1S/C19H17NO/c1-3-8-15(4-2)19(21)13-18-12-11-17(14-20-18)16-9-6-5-7-10-16/h3-12,14H,1-2,13H2/b15-8+ |
| InChIKey | RLJIDUGTHRCDME-OVCLIPMQSA-N |
| XLogP | 4.16 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|