About (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one
(3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one (PubChem CID 144852951) has the molecular formula C31H38O
and a molecular weight of 426.64 g/mol. Its IUPAC name is (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one |
| PubChem CID | 144852951 |
| Molecular Formula | C31H38O |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C=C)C(=O)Cc1c(C(C)(C)C)ccc(C(C)(C)C)c1CC(=C)c1ccccc1 |
| InChI | InChI=1S/C31H38O/c1-10-15-23(11-2)29(32)21-26-25(20-22(3)24-16-13-12-14-17-24)27(30(4,5)6)18-19-28(26)31(7,8)9/h10-19H,1-3,20-21H2,4-9H3/b23-15+ |
| InChIKey | TVDLDZOOXNQCNN-HZHRSRAPSA-N |
| XLogP | 7.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one?
The IUPAC name of (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one (CID 144852951) is (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one.
What is the SMILES notation for (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one?
The canonical SMILES for (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one is C=C/C=C(\C=C)C(=O)Cc1c(C(C)(C)C)ccc(C(C)(C)C)c1CC(=C)c1ccccc1.
What is the InChIKey of (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one?
The InChIKey is TVDLDZOOXNQCNN-HZHRSRAPSA-N. The full InChI is InChI=1S/C31H38O/c1-10-15-23(11-2)29(32)21-26-25(20-22(3)24-16-13-12-14-17-24)27(30(4,5)6)18-19-28(26)31(7,8)9/h10-19H,1-3,20-21H2,4-9H3/b23-15+.
What are the key properties of (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one?
(3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one has a molecular weight of 426.64 g/mol, XLogP of 7.95, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one is sourced from PubChem (CID 144852951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).