C31H38O — CID 144852951
(3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one (PubChem CID 144852951) has the molecular formula C31H38O and a molecular weight of 426.64 g/mol. Its IUPAC name is (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one.
| Compound Name | (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one |
|---|---|
| PubChem CID | 144852951 |
| Molecular Formula | C31H38O |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.29 |
| IUPAC Name | (3E)-1-[3,6-ditert-butyl-2-(2-phenylprop-2-enyl)phenyl]-3-ethenylhexa-3,5-dien-2-one |
| SMILES | C=C/C=C(\C=C)C(=O)Cc1c(C(C)(C)C)ccc(C(C)(C)C)c1CC(=C)c1ccccc1 |
| InChI | InChI=1S/C31H38O/c1-10-15-23(11-2)29(32)21-26-25(20-22(3)24-16-13-12-14-17-24)27(30(4,5)6)18-19-28(26)31(7,8)9/h10-19H,1-3,20-21H2,4-9H3/b23-15+ |
| InChIKey | TVDLDZOOXNQCNN-HZHRSRAPSA-N |
| XLogP | 7.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|