C15H13FO — CID 145193587
(2E,4Z)-4-(1-fluoroethenyl)-1-phenylhepta-2,4,6-trien-1-one (PubChem CID 145193587) has the molecular formula C15H13FO and a molecular weight of 228.27 g/mol. Its IUPAC name is (2E,4Z)-4-(1-fluoroethenyl)-1-phenylhepta-2,4,6-trien-1-one.
| Compound Name | (2E,4Z)-4-(1-fluoroethenyl)-1-phenylhepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 145193587 |
| Molecular Formula | C15H13FO |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | (2E,4Z)-4-(1-fluoroethenyl)-1-phenylhepta-2,4,6-trien-1-one |
| SMILES | C=C/C=C(/C=C/C(=O)c1ccccc1)C(=C)F |
| InChI | InChI=1S/C15H13FO/c1-3-7-13(12(2)16)10-11-15(17)14-8-5-4-6-9-14/h3-11H,1-2H2/b11-10+,13-7- |
| InChIKey | PPUWWWOEKYAHNS-DZSAWWLQSA-N |
| XLogP | 4.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|