C16H18FNO — CID 15866325
(2E,4Z)-4-fluoro-1-phenyl-5-piperidin-1-ylpenta-2,4-dien-1-one (PubChem CID 15866325) has the molecular formula C16H18FNO and a molecular weight of 259.32 g/mol. Its IUPAC name is (2E,4Z)-4-fluoro-1-phenyl-5-piperidin-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2E,4Z)-4-fluoro-1-phenyl-5-piperidin-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 15866325 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | (2E,4Z)-4-fluoro-1-phenyl-5-piperidin-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C=C/C(F)=C/N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H18FNO/c17-15(13-18-11-5-2-6-12-18)9-10-16(19)14-7-3-1-4-8-14/h1,3-4,7-10,13H,2,5-6,11-12H2/b10-9+,15-13- |
| InChIKey | NDDDYLIFQYUNST-OFPSORBISA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|