C20H21NO — CID 6377486
(Z)-1,3-diphenyl-3-piperidin-1-ylprop-2-en-1-one (PubChem CID 6377486) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-3-piperidin-1-ylprop-2-en-1-one.
| Compound Name | (Z)-1,3-diphenyl-3-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 6377486 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (Z)-1,3-diphenyl-3-piperidin-1-ylprop-2-en-1-one |
| SMILES | O=C(/C=C(/c1ccccc1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H21NO/c22-20(18-12-6-2-7-13-18)16-19(17-10-4-1-5-11-17)21-14-8-3-9-15-21/h1-2,4-7,10-13,16H,3,8-9,14-15H2/b19-16- |
| InChIKey | WXQOXQQWEANKJI-MNDPQUGUSA-N |
| XLogP | 4.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|