C31H16F15NSi — CID 177445819
tris(2,3,4,5,6-pentafluorophenyl)-[(Z)-2-phenyl-2-piperidin-1-ylethenyl]silane (PubChem CID 177445819) has the molecular formula C31H16F15NSi and a molecular weight of 715.53 g/mol. Its IUPAC name is tris(2,3,4,5,6-pentafluorophenyl)-[(Z)-2-phenyl-2-piperidin-1-ylethenyl]silane.
| Compound Name | tris(2,3,4,5,6-pentafluorophenyl)-[(Z)-2-phenyl-2-piperidin-1-ylethenyl]silane |
|---|---|
| PubChem CID | 177445819 |
| Molecular Formula | C31H16F15NSi |
| Molecular Weight | 715.53 g/mol |
| Exact Mass | 715.08 |
| IUPAC Name | tris(2,3,4,5,6-pentafluorophenyl)-[(Z)-2-phenyl-2-piperidin-1-ylethenyl]silane |
| SMILES | Fc1c(F)c(F)c([Si](/C=C(/c2ccccc2)N2CCCCC2)(c2c(F)c(F)c(F)c(F)c2F)c2c(F)c(F)c(F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C31H16F15NSi/c32-14-17(35)23(41)29(24(42)18(14)36)48(30-25(43)19(37)15(33)20(38)26(30)44,31-27(45)21(39)16(34)22(40)28(31)46)11-13(12-7-3-1-4-8-12)47-9-5-2-6-10-47/h1,3-4,7-8,11H,2,5-6,9-10H2/b13-11- |
| InChIKey | WGPWOMHZWHSCOH-QBFSEMIESA-N |
| XLogP | 7.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.53 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|