C24H35NO — CID 144927453
ethane;(3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol;methane (PubChem CID 144927453) has the molecular formula C24H35NO and a molecular weight of 353.55 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol;methane.
| Compound Name | ethane;(3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol;methane |
|---|---|
| PubChem CID | 144927453 |
| Molecular Formula | C24H35NO |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.27 |
| IUPAC Name | ethane;(3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)hexa-3,5-dien-2-ol;methane |
| SMILES | C.C=C/C=C(\C=C)C(O)Cc1ccc(-c2ccccc2)cn1.CC.CC |
| InChI | InChI=1S/C19H19NO.2C2H6.CH4/c1-3-8-15(4-2)19(21)13-18-12-11-17(14-20-18)16-9-6-5-7-10-16;2*1-2;/h3-12,14,19,21H,1-2,13H2;2*1-2H3;1H4/b15-8+;;; |
| InChIKey | XUICQIVLDXUMAL-BAESOZIDSA-N |
| XLogP | 6.64 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|