C21H25N — CID 144927518
2-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyridine (PubChem CID 144927518) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyridine.
| Compound Name | 2-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyridine |
|---|---|
| PubChem CID | 144927518 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 2-[(3E)-3-ethenyl-2-methylhexa-3,5-dienyl]-5-[(3E,5Z)-hepta-1,3,5-trien-3-yl]pyridine |
| SMILES | C=C/C=C(\C=C)C(C)Cc1ccc(/C(C=C)=C/C=C\C)cn1 |
| InChI | InChI=1S/C21H25N/c1-6-10-12-19(9-4)20-13-14-21(22-16-20)15-17(5)18(8-3)11-7-2/h6-14,16-17H,2-4,15H2,1,5H3/b10-6-,18-11+,19-12+ |
| InChIKey | IVRORPHIPMLPPZ-FVLBMJOESA-N |
| XLogP | 5.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|