C15H32O — CID 143979742
ethane;(3E,5Z)-3-ethenylhepta-3,5-dien-2-ol (PubChem CID 143979742) has the molecular formula C15H32O and a molecular weight of 228.42 g/mol. Its IUPAC name is ethane;(3E,5Z)-3-ethenylhepta-3,5-dien-2-ol.
| Compound Name | ethane;(3E,5Z)-3-ethenylhepta-3,5-dien-2-ol |
|---|---|
| PubChem CID | 143979742 |
| Molecular Formula | C15H32O |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.25 |
| IUPAC Name | ethane;(3E,5Z)-3-ethenylhepta-3,5-dien-2-ol |
| SMILES | C=C/C(=C\C=C/C)C(C)O.CC.CC.CC |
| InChI | InChI=1S/C9H14O.3C2H6/c1-4-6-7-9(5-2)8(3)10;3*1-2/h4-8,10H,2H2,1,3H3;3*1-2H3/b6-4-,9-7+;;; |
| InChIKey | LJLPGXJAVACWPD-XPSXWSNBSA-N |
| XLogP | 5.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|