C19H31N — CID 164573224
ethane;(2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-amine (PubChem CID 164573224) has the molecular formula C19H31N and a molecular weight of 273.46 g/mol. Its IUPAC name is ethane;(2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-amine.
| Compound Name | ethane;(2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 164573224 |
| Molecular Formula | C19H31N |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.25 |
| IUPAC Name | ethane;(2E,4Z)-2-ethenyl-N-methyl-1-phenylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C/C)C(NC)c1ccccc1.CC.CC |
| InChI | InChI=1S/C15H19N.2C2H6/c1-4-6-10-13(5-2)15(16-3)14-11-8-7-9-12-14;2*1-2/h4-12,15-16H,2H2,1,3H3;2*1-2H3/b6-4-,13-10+;; |
| InChIKey | LNAINOBLYKSQJN-RLFXBRAGSA-N |
| XLogP | 5.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|