C16H21N — CID 21102554
(2E,4E)-2-ethenyl-N-(1-phenylethyl)hexa-2,4-dien-1-amine (PubChem CID 21102554) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-N-(1-phenylethyl)hexa-2,4-dien-1-amine.
| Compound Name | (2E,4E)-2-ethenyl-N-(1-phenylethyl)hexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 21102554 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (2E,4E)-2-ethenyl-N-(1-phenylethyl)hexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C\C)CNC(C)c1ccccc1 |
| InChI | InChI=1S/C16H21N/c1-4-6-10-15(5-2)13-17-14(3)16-11-8-7-9-12-16/h4-12,14,17H,2,13H2,1,3H3/b6-4+,15-10+ |
| InChIKey | XZFUZZWGKKLGDD-SQXCIYSKSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|