C18H30NP — CID 176995490
(2E,4Z)-2-methyl-N-[phenyl(phosphanyl)methyl]hexa-2,4-dien-1-amine;2-methylpropane (PubChem CID 176995490) has the molecular formula C18H30NP and a molecular weight of 291.42 g/mol. Its IUPAC name is (2E,4Z)-2-methyl-N-[phenyl(phosphanyl)methyl]hexa-2,4-dien-1-amine;2-methylpropane.
| Compound Name | (2E,4Z)-2-methyl-N-[phenyl(phosphanyl)methyl]hexa-2,4-dien-1-amine;2-methylpropane |
|---|---|
| PubChem CID | 176995490 |
| Molecular Formula | C18H30NP |
| Molecular Weight | 291.42 g/mol |
| Exact Mass | 291.21 |
| IUPAC Name | (2E,4Z)-2-methyl-N-[phenyl(phosphanyl)methyl]hexa-2,4-dien-1-amine;2-methylpropane |
| SMILES | C/C=C\C=C(/C)CNC(P)c1ccccc1.CC(C)C |
| InChI | InChI=1S/C14H20NP.C4H10/c1-3-4-8-12(2)11-15-14(16)13-9-6-5-7-10-13;1-4(2)3/h3-10,14-15H,11,16H2,1-2H3;4H,1-3H3/b4-3-,12-8+; |
| InChIKey | MEMAIJUNNLZOBV-HVEZMERNSA-N |
| XLogP | 5.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.42 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|