C19H22P+ — CID 170234341
[(2E,4Z)-hexa-2,4-dien-2-yl]-methyl-diphenylphosphanium (PubChem CID 170234341) has the molecular formula C19H22P+ and a molecular weight of 281.36 g/mol. Its IUPAC name is [(2E,4Z)-hexa-2,4-dien-2-yl]-methyl-diphenylphosphanium.
| Compound Name | [(2E,4Z)-hexa-2,4-dien-2-yl]-methyl-diphenylphosphanium |
|---|---|
| PubChem CID | 170234341 |
| Molecular Formula | C19H22P+ |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | [(2E,4Z)-hexa-2,4-dien-2-yl]-methyl-diphenylphosphanium |
| SMILES | C/C=C\C=C(/C)[P+](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22P/c1-4-5-12-17(2)20(3,18-13-8-6-9-14-18)19-15-10-7-11-16-19/h4-16H,1-3H3/q+1/b5-4-,17-12+ |
| InChIKey | GFVISLPYQOFHLG-RUGYOBOGSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|