About ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene
ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene (PubChem CID 142101602) has the molecular formula C18H28
and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene.
Molecular Properties
| Compound Name | ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene |
| PubChem CID | 142101602 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene |
| SMILES | C/C=C\C=C(/CC)C(CC)c1ccccc1.CC |
| InChI | InChI=1S/C16H22.C2H6/c1-4-7-11-14(5-2)16(6-3)15-12-9-8-10-13-15;1-2/h4,7-13,16H,5-6H2,1-3H3;1-2H3/b7-4-,14-11+; |
| InChIKey | PACURSAZMUBNOG-QBAXTUGNSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene?
The IUPAC name of ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene (CID 142101602) is ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene.
What is the SMILES notation for ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene?
The canonical SMILES for ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene is C/C=C\C=C(/CC)C(CC)c1ccccc1.CC.
What is the InChIKey of ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene?
The InChIKey is PACURSAZMUBNOG-QBAXTUGNSA-N. The full InChI is InChI=1S/C16H22.C2H6/c1-4-7-11-14(5-2)16(6-3)15-12-9-8-10-13-15;1-2/h4,7-13,16H,5-6H2,1-3H3;1-2H3/b7-4-,14-11+;.
What are the key properties of ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene?
ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene has a molecular weight of 244.42 g/mol, XLogP of 6.12, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(4E,6Z)-4-ethylocta-4,6-dien-3-yl]benzene is sourced from PubChem (CID 142101602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).