C27H31O3P — CID 143617257
diphenyl [(3E,5Z)-2-phenylhepta-3,5-dien-3-yl] phosphite;ethane (PubChem CID 143617257) has the molecular formula C27H31O3P and a molecular weight of 434.52 g/mol. Its IUPAC name is diphenyl [(3E,5Z)-2-phenylhepta-3,5-dien-3-yl] phosphite;ethane.
| Compound Name | diphenyl [(3E,5Z)-2-phenylhepta-3,5-dien-3-yl] phosphite;ethane |
|---|---|
| PubChem CID | 143617257 |
| Molecular Formula | C27H31O3P |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | diphenyl [(3E,5Z)-2-phenylhepta-3,5-dien-3-yl] phosphite;ethane |
| SMILES | C/C=C\C=C(\OP(Oc1ccccc1)Oc1ccccc1)C(C)c1ccccc1.CC |
| InChI | InChI=1S/C25H25O3P.C2H6/c1-3-4-20-25(21(2)22-14-8-5-9-15-22)28-29(26-23-16-10-6-11-17-23)27-24-18-12-7-13-19-24;1-2/h3-21H,1-2H3;1-2H3/b4-3-,25-20+; |
| InChIKey | PJQYJFGMVOKMFV-GOKHEYCYSA-N |
| XLogP | 8.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|