[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen

C12H18 — CID 142935143

IUPAC[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen
SMILESC/C=C(/C)C(C)c1ccccc1.[H][H]
InChIInChI=1S/C12H16.H2/c1-4-10(2)11(3)12-8-6-5-7-9-12;/h4-9,11H,1-3H3;1H/b10-4-;
InChIKeyVGLGTGTYMATNMM-MDZFRNKHSA-N
MW162.28 g/mol
LogP4.00
Rot. Bonds2

About [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen

[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen (PubChem CID 142935143) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen.

Molecular Properties

Compound Name[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen
PubChem CID142935143
Molecular FormulaC12H18
Molecular Weight162.28 g/mol
Exact Mass162.14
IUPAC Name[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen
SMILESC/C=C(/C)C(C)c1ccccc1.[H][H]
InChIInChI=1S/C12H16.H2/c1-4-10(2)11(3)12-8-6-5-7-9-12;/h4-9,11H,1-3H3;1H/b10-4-;
InChIKeyVGLGTGTYMATNMM-MDZFRNKHSA-N
XLogP4.00
TPSA0.00 Ų
H-Bond Donors
H-Bond Acceptors
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.28
LogP ≤ 54.00
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen?
The IUPAC name of [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen (CID 142935143) is [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen.
What is the SMILES notation for [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen?
The canonical SMILES for [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen is C/C=C(/C)C(C)c1ccccc1.[H][H].
What is the InChIKey of [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen?
The InChIKey is VGLGTGTYMATNMM-MDZFRNKHSA-N. The full InChI is InChI=1S/C12H16.H2/c1-4-10(2)11(3)12-8-6-5-7-9-12;/h4-9,11H,1-3H3;1H/b10-4-;.
What are the key properties of [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen?
[(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen has a molecular weight of 162.28 g/mol, XLogP of 4.00, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-3-methylpent-3-en-2-yl]benzene;molecular hydrogen is sourced from PubChem (CID 142935143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).