C15H15NO — CID 98569832
(NZ)-N-[(2S)-1,2-diphenylpropylidene]hydroxylamine (PubChem CID 98569832) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is (NZ)-N-[(2S)-1,2-diphenylpropylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(2S)-1,2-diphenylpropylidene]hydroxylamine |
|---|---|
| PubChem CID | 98569832 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | (NZ)-N-[(2S)-1,2-diphenylpropylidene]hydroxylamine |
| SMILES | C[C@H](/C(=N/O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H15NO/c1-12(13-8-4-2-5-9-13)15(16-17)14-10-6-3-7-11-14/h2-12,17H,1H3/b16-15-/t12-/m0/s1 |
| InChIKey | YTKPYWFDRHHTTK-SUQMRRJOSA-N |
| XLogP | 3.67 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|