C22H31NO2Sn — CID 6310409
dibutyltin;(2Z)-2-hydroxyimino-1,2-diphenylethanol (PubChem CID 6310409) has the molecular formula C22H31NO2Sn and a molecular weight of 460.21 g/mol. Its IUPAC name is dibutyltin;(2Z)-2-hydroxyimino-1,2-diphenylethanol.
| Compound Name | dibutyltin;(2Z)-2-hydroxyimino-1,2-diphenylethanol |
|---|---|
| PubChem CID | 6310409 |
| Molecular Formula | C22H31NO2Sn |
| Molecular Weight | 460.21 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | dibutyltin;(2Z)-2-hydroxyimino-1,2-diphenylethanol |
| SMILES | CCCC[Sn]CCCC.O/N=C(/c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2.2C4H9.Sn/c16-14(12-9-5-2-6-10-12)13(15-17)11-7-3-1-4-8-11;2*1-3-4-2;/h1-10,14,16-17H;2*1,3-4H2,2H3;/b15-13-;;; |
| InChIKey | GXPMNUSIGLIUCZ-WJPKGVJZSA-N |
| XLogP | 5.73 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.21 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|