C28H24N2O2 — CID 7340294
(1R,2Z)-2-[(E)-[(2S)-2-hydroxy-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanol (PubChem CID 7340294) has the molecular formula C28H24N2O2 and a molecular weight of 420.51 g/mol. Its IUPAC name is (1R,2Z)-2-[(E)-[(2S)-2-hydroxy-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanol.
| Compound Name | (1R,2Z)-2-[(E)-[(2S)-2-hydroxy-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanol |
|---|---|
| PubChem CID | 7340294 |
| Molecular Formula | C28H24N2O2 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | (1R,2Z)-2-[(E)-[(2S)-2-hydroxy-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanol |
| SMILES | O[C@H](/C(=N/N=C(/c1ccccc1)[C@H](O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24N2O2/c31-27(23-17-9-3-10-18-23)25(21-13-5-1-6-14-21)29-30-26(22-15-7-2-8-16-22)28(32)24-19-11-4-12-20-24/h1-20,27-28,31-32H/b29-25-,30-26+/t27-,28+/m1/s1 |
| InChIKey | LZSAGKJUELTLJL-QXLZZLHKSA-N |
| XLogP | 5.35 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|