C21H18N2O3 — CID 6371713
[(E)-(2-hydroxy-1,2-diphenylethylidene)amino] N-phenylcarbamate (PubChem CID 6371713) has the molecular formula C21H18N2O3 and a molecular weight of 346.39 g/mol. Its IUPAC name is [(E)-(2-hydroxy-1,2-diphenylethylidene)amino] N-phenylcarbamate.
| Compound Name | [(E)-(2-hydroxy-1,2-diphenylethylidene)amino] N-phenylcarbamate |
|---|---|
| PubChem CID | 6371713 |
| Molecular Formula | C21H18N2O3 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(E)-(2-hydroxy-1,2-diphenylethylidene)amino] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)O/N=C(\c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C21H18N2O3/c24-20(17-12-6-2-7-13-17)19(16-10-4-1-5-11-16)23-26-21(25)22-18-14-8-3-9-15-18/h1-15,20,24H,(H,22,25)/b23-19+ |
| InChIKey | OGKLGPZFFQIRHC-FCDQGJHFSA-N |
| XLogP | 4.37 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|